Cím: Megoldásvázlatok,erdmények a II.mérőlap feladataihoz
Szerző(k):  Rábai Imre 
Füzet: 1997/január, 12 - 14. oldal  PDF file
Témakör(ök): Felvételi előkészítő feladatsor

 
1. a) Ha q=1, akkor 2n=16 és 12n=4, azaz n=8, így a sorozat minden tagja 2.
Ha q1, akkor 16=2qn-1q-1 és 4=12(1q)n-11q-1, azaz qn-1q-1=8 és 8=1qn-11-qn1-q, amiből qn-1=1, qn=q, tehát q-1q-1=8, azaz ilyen sorozat nem létezik.
b) Ha q=1, akkor n12=20 és 2n=8027, azaz ilyen sorozat nem létezik.
Ha q1, akkor 20=12qn-1q-1 és 8027=2(1q)n-11q-1, azaz qn-1q-1=40 és
4027=1qn-11-qn1-q, amiből qn-1=27, qn=27q, azaz 27q-1=40(q-1), q=3, és így n=4. A sorozat első négy tagja: 12, 32, 92, 272.
 
2. a) A háromszög területe Heron-képlettel kiszámítható. Most 2s=54,4, s=27,2, tehát
T2=27,21,75,120,4=69,362,  T=69,36 területegység.
b) Ismeretes, hogy a háromszög területe T=abc4r, tehát a háromszög köré írható kör sugara r=abc4T. Most r=6,822,125,5469,36=22116=13,8125 egység.
c) Ismeretes, hogy a háromszögbe írható kör sugara ϱ=Ts; most ϱ=69,3627,2=2,55.
 
3. Vonjuk ki az első egyenletből a másodikat, a második egyenletből a harmadikat, és ezekhez társítsuk az első egyenletet. Ekkor rendezés után kapjuk:
(z-x)(2x+2z+1)=0,(x-y)(2x+2y+1)=0ésx+y=2z2.
Egyenletrendszerünk megoldásait a következő négy egyenletrendszer megoldásainak egyesítése adja:
a) z=x, x=y, x+y=2z2;
b) z=x, 2x+2y+1=0, x+y=2z2;
c) 2z+2x+1=0, x=y, x+y=2z2;
d) 2z+2x+1=0, 2x+2y+1=0, x+y=2z2.
Ezek közül csak az a) esetben adódik megoldás, és ezek az adott egyenletrendszernek is megoldásai. A megoldások: x1=0, y1=0, z1=0 és x2=1, y2=1, z2=1.
 
4. Vegyük figyelembe, hogy  cos75=14(6-2)  és  sin75=14(6+2)  és
cos(x+75)=14((6-2)cosx-(6+2)sinx).
Írjunk az első, majd a második kifejezésbe a, b, c, illetve α, β, γ helyébe rendre b, c, a-t, illetve β, γ, α-t, ekkor a második kifejezést, illetve a
c2+a2-(6+2)cacos(β+75)
kifejezést kapjuk, ami az első kettővel egyenlő, hiszen így mindhárom kifejezés a következő alakra hozható:
a2+b2-(6+2)ab14((6-2)cosγ-(6+2)sinγ)==a2+b2-abcosγ+(6+2)22absinγ2==a2+b2-a2+b2-c22+(4+23)T=a2+b2+c22+(4+23)T,
ahol T a háromszög területe.
 
5. Azonos átalakításokkal
f(x)=((log2x-3)2-9)2.
A függvény legnagyobb értéke 81, amit az x=8 helyen vesz fel.
 
6. Jelölje a hitelt H, legyen q1=1+2,5100=1,025 és q2=1+2100=1,02. Az első, a második, illetve a harmadik hónap végén a tartozásunk
t1=Hq1-x,t2=Hq12-xq1-x,t3=Hq13-xq3-1q-1=K,
ahol x a havi törlesztőrészlet.
A negyedik, az ötödik, illetve a hatodik hónap végén a tartozásunk
t4=Kq2-2x,t5=Kq22-2xq2-2x,t6=Kq23-2xq23-1q2-1.
A feltétel szerint t6=0, tehát
Hq13q23-xq23q13-1q-1-2xq23-1q2-1=0,
ahonnan
x=Hq13q23q23q13-1q1-1+2q23-1q2-1.
A számolást elvégezve, az első három hónapban a törlesztés x=12177,4 Ft, a második hónapban pedig 24354,8 Ft volt.
 
7. A feltételeknek négy rombusz felel meg. A körök középpontjai rajta vannak az adott két oldalegyenes szögfelezőegyenesein, valamint az egyik egyenestől ϱ távolságban haladó (párhuzamos) egyeneseken. A szögfelezők egyenlete:
|x-y-7|2=|x+7y-31|52,
azaz
x-3y=1,illetve3x+y=33.
Az x-y-7=0 egyenessel párhuzamos egyenesek egyenlete x-y+k=0 alakban írható. Ezek közül a keresettek az x-y-7=0 egyenletű egyenes bármely (pl. a (7,0)) pontjától 22 távolságra vannak, tehát
22=|7+k|2,azazk=-3vagyk=-11,
így x-y=11 vagy x-y=3. Ezeknek az egyeneseknek a szögfelezőkkel való metszéspontjai a keresett körök középpontjai. Ezek K1(4;1), K2(9;6), K3(16;5), K4(11;0). A középpont és a sugár ismeretében a körök egyenlete felírható.
 
8. Az egyenletnek x=1 nem lehet megoldása. Emeljük négyzetre az egyenlet mindkét oldalát, majd rendezzük:
x(x-1+2p)=0.
x1=0 akkor gyöke az egyenletnek, ha p2=p, azaz ha p0.

x2=1-2p akkor gyöke az egyenletnek, ha p0 és
(2p-32)2=32-2p,azaz|2p-32|=32-2p,
tehát 2p-320,  p34.
Az egyenletnek 0<p34 esetén van két különböző gyöke.

Rábai Imre